C22H19N5O2S — CID 2417320
1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 2417320) has the molecular formula C22H19N5O2S and a molecular weight of 417.49 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 2417320 |
| Molecular Formula | C22H19N5O2S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | C=CCn1c(=O)c2ccccc2n2c(SCC(=O)N3CCc4ccccc43)nnc12 |
| InChI | InChI=1S/C22H19N5O2S/c1-2-12-26-20(29)16-8-4-6-10-18(16)27-21(26)23-24-22(27)30-14-19(28)25-13-11-15-7-3-5-9-17(15)25/h2-10H,1,11-14H2 |
| InChIKey | ZDLCGDQGPRREFI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|