C22H23ClN4O3 — CID 2417400
N-[(4-chlorophenyl)methyl]-2-[2-(morpholin-4-ylmethyl)-4-oxoquinazolin-3-yl]acetamide (PubChem CID 2417400) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[2-(morpholin-4-ylmethyl)-4-oxoquinazolin-3-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[2-(morpholin-4-ylmethyl)-4-oxoquinazolin-3-yl]acetamide |
|---|---|
| PubChem CID | 2417400 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[2-(morpholin-4-ylmethyl)-4-oxoquinazolin-3-yl]acetamide |
| SMILES | O=C(Cn1c(CN2CCOCC2)nc2ccccc2c1=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN4O3/c23-17-7-5-16(6-8-17)13-24-21(28)15-27-20(14-26-9-11-30-12-10-26)25-19-4-2-1-3-18(19)22(27)29/h1-8H,9-15H2,(H,24,28) |
| InChIKey | FMBXJRMGPWMLSA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |