C18H18ClN3O4 — CID 2417505
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 6-chloropyridine-3-carboxylate (PubChem CID 2417505) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2417505 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(Cl)nc1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H18ClN3O4/c19-16-6-1-13(11-20-16)18(24)26-12-17(23)21-14-2-4-15(5-3-14)22-7-9-25-10-8-22/h1-6,11H,7-10,12H2,(H,21,23) |
| InChIKey | MZVDYYSYEHKGTP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|