About N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide
N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide (PubChem CID 2417583) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide.
Molecular Properties
| Compound Name | N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide |
| PubChem CID | 2417583 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide |
| SMILES | C[C@H]1CC(NNC(=O)C2CC2)=CC(C)(C)C1 |
| InChI | InChI=1S/C13H22N2O/c1-9-6-11(8-13(2,3)7-9)14-15-12(16)10-4-5-10/h8-10,14H,4-7H2,1-3H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | RJICAWJVWGXEMY-VIFPVBQESA-N |
| XLogP | 2.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide?
The IUPAC name of N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide (CID 2417583) is N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide.
What is the SMILES notation for N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide?
The canonical SMILES for N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide is C[C@H]1CC(NNC(=O)C2CC2)=CC(C)(C)C1.
What is the InChIKey of N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide?
The InChIKey is RJICAWJVWGXEMY-VIFPVBQESA-N. The full InChI is InChI=1S/C13H22N2O/c1-9-6-11(8-13(2,3)7-9)14-15-12(16)10-4-5-10/h8-10,14H,4-7H2,1-3H3,(H,15,16)/t9-/m0/s1.
What are the key properties of N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide?
N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide has a molecular weight of 222.33 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]cyclopropanecarbohydrazide is sourced from PubChem (CID 2417583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).