About 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide
1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide (PubChem CID 2419349) has the molecular formula C13H17N4O2S+
and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide.
Molecular Properties
| Compound Name | 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide |
| PubChem CID | 2419349 |
| Molecular Formula | C13H17N4O2S+ |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1CC[NH+](Cc2cc(=O)n3ccsc3n2)CC1 |
| InChI | InChI=1S/C13H16N4O2S/c14-12(19)9-1-3-16(4-2-9)8-10-7-11(18)17-5-6-20-13(17)15-10/h5-7,9H,1-4,8H2,(H2,14,19)/p+1 |
| InChIKey | GTUXBAVIRXZPSE-UHFFFAOYSA-O |
| XLogP | -0.96 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide?
The IUPAC name of 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide (CID 2419349) is 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide.
What is the SMILES notation for 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide?
The canonical SMILES for 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide is NC(=O)C1CC[NH+](Cc2cc(=O)n3ccsc3n2)CC1.
What is the InChIKey of 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide?
The InChIKey is GTUXBAVIRXZPSE-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H16N4O2S/c14-12(19)9-1-3-16(4-2-9)8-10-7-11(18)17-5-6-20-13(17)15-10/h5-7,9H,1-4,8H2,(H2,14,19)/p+1.
What are the key properties of 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide?
1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide has a molecular weight of 293.37 g/mol, XLogP of -0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]piperidin-1-ium-4-carboxamide is sourced from PubChem (CID 2419349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).