C12H16N2O2 — CID 2419804
N-cyclohexyl-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 2419804) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-cyclohexyl-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-cyclohexyl-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2419804 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-cyclohexyl-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | C1CCC(CC1)NC(=O)C2=CNC(=O)C=C2 |
| InChI | InChI=1S/C12H16N2O2/c15-11-7-6-9(8-13-11)12(16)14-10-4-2-1-3-5-10/h6-8,10H,1-5H2,(H,13,15)(H,14,16) |
| InChIKey | GQMVRCWUKNCXGZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 352 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |