C10H9Cl3N6OS — CID 2420702
2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-(2,4,6-trichlorophenyl)acetohydrazide (PubChem CID 2420702) has the molecular formula C10H9Cl3N6OS and a molecular weight of 367.65 g/mol. Its IUPAC name is 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-(2,4,6-trichlorophenyl)acetohydrazide.
| Compound Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-(2,4,6-trichlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 2420702 |
| Molecular Formula | C10H9Cl3N6OS |
| Molecular Weight | 367.65 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N'-(2,4,6-trichlorophenyl)acetohydrazide |
| SMILES | Nc1nc(SCC(=O)NNc2c(Cl)cc(Cl)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C10H9Cl3N6OS/c11-4-1-5(12)8(6(13)2-4)17-16-7(20)3-21-10-15-9(14)18-19-10/h1-2,17H,3H2,(H,16,20)(H3,14,15,18,19) |
| InChIKey | OWLKGRITIIBQHV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.65 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|