About [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate
[3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate (PubChem CID 2420720) has the molecular formula C18H15N3O6
and a molecular weight of 369.33 g/mol. Its IUPAC name is [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate.
Molecular Properties
| Compound Name | [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate |
| PubChem CID | 2420720 |
| Molecular Formula | C18H15N3O6 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate |
| SMILES | COc1cc2nc(COC(=O)c3ccco3)n(CC#N)c(=O)c2cc1OC |
| InChI | InChI=1S/C18H15N3O6/c1-24-14-8-11-12(9-15(14)25-2)20-16(21(6-5-19)17(11)22)10-27-18(23)13-4-3-7-26-13/h3-4,7-9H,6,10H2,1-2H3 |
| InChIKey | RKAOQROHUQEBTH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 116.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate?
The IUPAC name of [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate (CID 2420720) is [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate.
What is the SMILES notation for [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate?
The canonical SMILES for [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate is COc1cc2nc(COC(=O)c3ccco3)n(CC#N)c(=O)c2cc1OC.
What is the InChIKey of [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate?
The InChIKey is RKAOQROHUQEBTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O6/c1-24-14-8-11-12(9-15(14)25-2)20-16(21(6-5-19)17(11)22)10-27-18(23)13-4-3-7-26-13/h3-4,7-9H,6,10H2,1-2H3.
What are the key properties of [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate?
[3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate has a molecular weight of 369.33 g/mol, XLogP of 1.89, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(cyanomethyl)-6,7-dimethoxy-4-oxoquinazolin-2-yl]methyl furan-2-carboxylate is sourced from PubChem (CID 2420720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).