About 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide
2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide (PubChem CID 2420735) has the molecular formula C21H20N2O5S2
and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide |
| PubChem CID | 2420735 |
| Molecular Formula | C21H20N2O5S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2oc(SCC(=O)c3cc4ccccc4o3)nc2c1 |
| InChI | InChI=1S/C21H20N2O5S2/c1-3-23(4-2)30(25,26)15-9-10-19-16(12-15)22-21(28-19)29-13-17(24)20-11-14-7-5-6-8-18(14)27-20/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | UEHCRGMNXUJEKR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 93.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide?
The IUPAC name of 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide (CID 2420735) is 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide.
What is the SMILES notation for 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide?
The canonical SMILES for 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide is CCN(CC)S(=O)(=O)c1ccc2oc(SCC(=O)c3cc4ccccc4o3)nc2c1.
What is the InChIKey of 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide?
The InChIKey is UEHCRGMNXUJEKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O5S2/c1-3-23(4-2)30(25,26)15-9-10-19-16(12-15)22-21(28-19)29-13-17(24)20-11-14-7-5-6-8-18(14)27-20/h5-12H,3-4,13H2,1-2H3.
What are the key properties of 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide?
2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide has a molecular weight of 444.53 g/mol, XLogP of 4.58, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-N,N-diethyl-1,3-benzoxazole-5-sulfonamide is sourced from PubChem (CID 2420735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).