About methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate
methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate (PubChem CID 2421557) has the molecular formula C23H25NO6
and a molecular weight of 411.45 g/mol. Its IUPAC name is methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate |
| PubChem CID | 2421557 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate |
| SMILES | COC(=O)CCc1c(C)c(C(=O)c2cc(OC)c(OC)c(OC)c2)c2ccccn12 |
| InChI | InChI=1S/C23H25NO6/c1-14-16(9-10-20(25)29-4)24-11-7-6-8-17(24)21(14)22(26)15-12-18(27-2)23(30-5)19(13-15)28-3/h6-8,11-13H,9-10H2,1-5H3 |
| InChIKey | SVDOKMCTKFPRGA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate?
The IUPAC name of methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate (CID 2421557) is methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate.
What is the SMILES notation for methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate?
The canonical SMILES for methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate is COC(=O)CCc1c(C)c(C(=O)c2cc(OC)c(OC)c(OC)c2)c2ccccn12.
What is the InChIKey of methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate?
The InChIKey is SVDOKMCTKFPRGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO6/c1-14-16(9-10-20(25)29-4)24-11-7-6-8-17(24)21(14)22(26)15-12-18(27-2)23(30-5)19(13-15)28-3/h6-8,11-13H,9-10H2,1-5H3.
What are the key properties of methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate?
methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate has a molecular weight of 411.45 g/mol, XLogP of 3.61, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-methyl-1-(3,4,5-trimethoxybenzoyl)indolizin-3-yl]propanoate is sourced from PubChem (CID 2421557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).