C14H23NO3 — CID 2421900
2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)cyclohexyl]acetic acid (PubChem CID 2421900) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)cyclohexyl]acetic acid.
| Compound Name | 2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 2421900 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(CC(=O)N2CCCC2)CCCCC1 |
| InChI | InChI=1S/C14H23NO3/c16-12(15-8-4-5-9-15)10-14(11-13(17)18)6-2-1-3-7-14/h1-11H2,(H,17,18) |
| InChIKey | VGBJYXCCEGFPJQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |