C19H18N4O6 — CID 2422325
ethyl 1,3-dimethyl-7-(4-methyl-3-nitrophenyl)-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxylate (PubChem CID 2422325) has the molecular formula C19H18N4O6 and a molecular weight of 398.38 g/mol. Its IUPAC name is ethyl 1,3-dimethyl-7-(4-methyl-3-nitrophenyl)-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 1,3-dimethyl-7-(4-methyl-3-nitrophenyl)-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2422325 |
| Molecular Formula | C19H18N4O6 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | ethyl 1,3-dimethyl-7-(4-methyl-3-nitrophenyl)-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(C)c([N+](=O)[O-])c2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C19H18N4O6/c1-5-29-18(25)12-9-13(11-7-6-10(2)14(8-11)23(27)28)20-16-15(12)17(24)22(4)19(26)21(16)3/h6-9H,5H2,1-4H3 |
| InChIKey | QUNJMCFCPJVSQQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 126.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|