C22H26N4O3 — CID 2422588
[2-[4-(diethylamino)anilino]-2-oxoethyl] 2-(2-methylbenzimidazol-1-yl)acetate (PubChem CID 2422588) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is [2-[4-(diethylamino)anilino]-2-oxoethyl] 2-(2-methylbenzimidazol-1-yl)acetate.
| Compound Name | [2-[4-(diethylamino)anilino]-2-oxoethyl] 2-(2-methylbenzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 2422588 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [2-[4-(diethylamino)anilino]-2-oxoethyl] 2-(2-methylbenzimidazol-1-yl)acetate |
| SMILES | CCN(CC)c1ccc(NC(=O)COC(=O)Cn2c(C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-4-25(5-2)18-12-10-17(11-13-18)24-21(27)15-29-22(28)14-26-16(3)23-19-8-6-7-9-20(19)26/h6-13H,4-5,14-15H2,1-3H3,(H,24,27) |
| InChIKey | ALWFCCRIGLQGAR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|