C16H9F6N3O2 — CID 2423874
1-benzyl-5,7-bis(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 2423874) has the molecular formula C16H9F6N3O2 and a molecular weight of 389.26 g/mol. Its IUPAC name is 1-benzyl-5,7-bis(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-benzyl-5,7-bis(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2423874 |
| Molecular Formula | C16H9F6N3O2 |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 1-benzyl-5,7-bis(trifluoromethyl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2)c2nc(C(F)(F)F)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C16H9F6N3O2/c17-15(18,19)9-6-10(16(20,21)22)23-12-11(9)13(26)24-14(27)25(12)7-8-4-2-1-3-5-8/h1-6H,7H2,(H,24,26,27) |
| InChIKey | MYZJSKTZBZCUPN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |