C20H11NO2 — CID 24241
12H-naphtho[3,2-a]carbazole-5,13-dione (PubChem CID 24241) has the molecular formula C20H11NO2 and a molecular weight of 297.31 g/mol. Its IUPAC name is 12H-naphtho[3,2-a]carbazole-5,13-dione.
| Compound Name | 12H-naphtho[3,2-a]carbazole-5,13-dione |
|---|---|
| PubChem CID | 24241 |
| Molecular Formula | C20H11NO2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 12H-naphtho[3,2-a]carbazole-5,13-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1c2[nH]c2ccccc21 |
| InChI | InChI=1S/C20H11NO2/c22-19-13-6-1-2-7-14(13)20(23)17-15(19)10-9-12-11-5-3-4-8-16(11)21-18(12)17/h1-10,21H |
| InChIKey | JKKLCMHYJFHIOQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|