C19H19NO6 — CID 2424708
[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 3,4,5-trihydroxybenzoate (PubChem CID 2424708) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 2424708 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(O)c(O)c(O)c1)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C19H19NO6/c21-15-8-12(9-16(22)18(15)24)19(25)26-10-17(23)20-14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,8-9,14,21-22,24H,3,5,7,10H2,(H,20,23)/t14-/m1/s1 |
| InChIKey | PBFMOMKWMGXYSH-CQSZACIVSA-N |
| XLogP | 2.15 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|