C12H15NO4 — CID 2425269
[2-oxo-2-(propan-2-ylamino)ethyl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 2425269) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylamino)ethyl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(propan-2-ylamino)ethyl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2425269 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | [2-oxo-2-(propan-2-ylamino)ethyl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | CC(C)NC(=O)COC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C12H15NO4/c1-9(2)13-11(14)8-17-12(15)6-5-10-4-3-7-16-10/h3-7,9H,8H2,1-2H3,(H,13,14)/b6-5+ |
| InChIKey | XDFMJRYBNHCWKP-AATRIKPKSA-N |
| XLogP | 1.36 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|