C23H15Cl3F2N4O — CID 2425563
(2S)-10,12,13-trichloro-2-[4-(difluoromethoxy)phenyl]-4-methyl-6-phenyl-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene (PubChem CID 2425563) has the molecular formula C23H15Cl3F2N4O and a molecular weight of 507.76 g/mol. Its IUPAC name is (2S)-10,12,13-trichloro-2-[4-(difluoromethoxy)phenyl]-4-methyl-6-phenyl-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene.
| Compound Name | (2S)-10,12,13-trichloro-2-[4-(difluoromethoxy)phenyl]-4-methyl-6-phenyl-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene |
|---|---|
| PubChem CID | 2425563 |
| Molecular Formula | C23H15Cl3F2N4O |
| Molecular Weight | 507.76 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | (2S)-10,12,13-trichloro-2-[4-(difluoromethoxy)phenyl]-4-methyl-6-phenyl-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene |
| SMILES | Cc1nn(-c2ccccc2)c2c1[C@H](c1ccc(OC(F)F)cc1)N1C(=N2)C(Cl)=CC(Cl)=C1Cl |
| InChI | InChI=1S/C23H15Cl3F2N4O/c1-12-18-19(13-7-9-15(10-8-13)33-23(27)28)31-20(26)16(24)11-17(25)21(31)29-22(18)32(30-12)14-5-3-2-4-6-14/h2-11,19,23H,1H3/t19-/m0/s1 |
| InChIKey | DEISAYHBKCWQEX-IBGZPJMESA-N |
| XLogP | 7.00 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.76 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|