C20H19ClN2O3S — CID 2425635
[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinan-3-yl]-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanone (PubChem CID 2425635) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is [2-(3-chloro-4-methylphenyl)imino-1,3-thiazinan-3-yl]-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanone.
| Compound Name | [2-(3-chloro-4-methylphenyl)imino-1,3-thiazinan-3-yl]-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanone |
|---|---|
| PubChem CID | 2425635 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | [2-(3-chloro-4-methylphenyl)imino-1,3-thiazinan-3-yl]-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanone |
| SMILES | Cc1ccc(/N=C2\SCCCN2C(=O)[C@@H]2COc3ccccc3O2)cc1Cl |
| InChI | InChI=1S/C20H19ClN2O3S/c1-13-7-8-14(11-15(13)21)22-20-23(9-4-10-27-20)19(24)18-12-25-16-5-2-3-6-17(16)26-18/h2-3,5-8,11,18H,4,9-10,12H2,1H3/b22-20-/t18-/m0/s1 |
| InChIKey | HUIACRKRWLGKDP-BKBKCADHSA-N |
| XLogP | 4.44 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|