C20H12F4N4O6S3 — CID 2425975
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[[5-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 2425975) has the molecular formula C20H12F4N4O6S3 and a molecular weight of 576.53 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[[5-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[[5-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2425975 |
| Molecular Formula | C20H12F4N4O6S3 |
| Molecular Weight | 576.53 g/mol |
| Exact Mass | 575.99 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[[5-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(SCC(=O)Nc2ccc3c(c2)OC(F)(F)O3)s1)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C20H12F4N4O6S3/c21-19(22)31-11-3-1-9(5-13(11)33-19)25-15(29)7-35-17-27-28-18(37-17)36-8-16(30)26-10-2-4-12-14(6-10)34-20(23,24)32-12/h1-6H,7-8H2,(H,25,29)(H,26,30) |
| InChIKey | DXQZAHFGWSQGDU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |