C16H22N5O2+ — CID 2426288
6-amino-1-benzyl-5-(4-methylpiperazin-4-ium-1-yl)pyrimidine-2,4-dione (PubChem CID 2426288) has the molecular formula C16H22N5O2+ and a molecular weight of 316.38 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-(4-methylpiperazin-4-ium-1-yl)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-(4-methylpiperazin-4-ium-1-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2426288 |
| Molecular Formula | C16H22N5O2+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 6-amino-1-benzyl-5-(4-methylpiperazin-4-ium-1-yl)pyrimidine-2,4-dione |
| SMILES | C[NH+]1CCN(c2c(N)n(Cc3ccccc3)c(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C16H21N5O2/c1-19-7-9-20(10-8-19)13-14(17)21(16(23)18-15(13)22)11-12-5-3-2-4-6-12/h2-6H,7-11,17H2,1H3,(H,18,22,23)/p+1 |
| InChIKey | QFYYPSSEEMWLRC-UHFFFAOYSA-O |
| XLogP | -1.50 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |