C20H17N5OS — CID 2426745
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-1,3-diphenylpyrazole-5-carboxamide (PubChem CID 2426745) has the molecular formula C20H17N5OS and a molecular weight of 375.46 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-1,3-diphenylpyrazole-5-carboxamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-1,3-diphenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 2426745 |
| Molecular Formula | C20H17N5OS |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-1,3-diphenylpyrazole-5-carboxamide |
| SMILES | CCc1nnc(NC(=O)c2cc(-c3ccccc3)nn2-c2ccccc2)s1 |
| InChI | InChI=1S/C20H17N5OS/c1-2-18-22-23-20(27-18)21-19(26)17-13-16(14-9-5-3-6-10-14)24-25(17)15-11-7-4-8-12-15/h3-13H,2H2,1H3,(H,21,23,26) |
| InChIKey | DKELKMQNSSEVBM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |