About 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine
3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine (PubChem CID 2427302) has the molecular formula C16H8Cl4N2O2
and a molecular weight of 402.06 g/mol. Its IUPAC name is 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine.
Molecular Properties
| Compound Name | 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine |
| PubChem CID | 2427302 |
| Molecular Formula | C16H8Cl4N2O2 |
| Molecular Weight | 402.06 g/mol |
| Exact Mass | 399.93 |
| IUPAC Name | 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine |
| SMILES | Clc1ccc(Cl)c(Oc2ccc(Oc3nc(Cl)ccc3Cl)cc2)n1 |
| InChI | InChI=1S/C16H8Cl4N2O2/c17-11-5-7-13(19)21-15(11)23-9-1-2-10(4-3-9)24-16-12(18)6-8-14(20)22-16/h1-8H |
| InChIKey | MRNRDFOQXNZICL-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.06 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine?
The IUPAC name of 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine (CID 2427302) is 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine.
What is the SMILES notation for 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine?
The canonical SMILES for 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine is Clc1ccc(Cl)c(Oc2ccc(Oc3nc(Cl)ccc3Cl)cc2)n1.
What is the InChIKey of 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine?
The InChIKey is MRNRDFOQXNZICL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8Cl4N2O2/c17-11-5-7-13(19)21-15(11)23-9-1-2-10(4-3-9)24-16-12(18)6-8-14(20)22-16/h1-8H.
What are the key properties of 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine?
3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine has a molecular weight of 402.06 g/mol, XLogP of 6.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloro-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]pyridine is sourced from PubChem (CID 2427302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).