About [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate (PubChem CID 2428350) has the molecular formula C24H22ClNO3
and a molecular weight of 407.90 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate.
Molecular Properties
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate |
| PubChem CID | 2428350 |
| Molecular Formula | C24H22ClNO3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate |
| SMILES | O=C(COC(=O)CC(c1ccccc1)c1ccccc1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClNO3/c25-21-13-11-18(12-14-21)16-26-23(27)17-29-24(28)15-22(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-14,22H,15-17H2,(H,26,27) |
| InChIKey | KTMNXELORYZTQF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate?
The IUPAC name of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate (CID 2428350) is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate.
What is the SMILES notation for [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate?
The canonical SMILES for [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate is O=C(COC(=O)CC(c1ccccc1)c1ccccc1)NCc1ccc(Cl)cc1.
What is the InChIKey of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate?
The InChIKey is KTMNXELORYZTQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22ClNO3/c25-21-13-11-18(12-14-21)16-26-23(27)17-29-24(28)15-22(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-14,22H,15-17H2,(H,26,27).
What are the key properties of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate?
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate has a molecular weight of 407.90 g/mol, XLogP of 4.72, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3,3-diphenylpropanoate is sourced from PubChem (CID 2428350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).