C25H22ClN5O3S2 — CID 2428478
ethyl 2-[[(6R,7S)-6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carbonyl]amino]-5-phenylthiophene-3-carboxylate (PubChem CID 2428478) has the molecular formula C25H22ClN5O3S2 and a molecular weight of 540.07 g/mol. Its IUPAC name is ethyl 2-[[(6R,7S)-6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carbonyl]amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(6R,7S)-6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carbonyl]amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2428478 |
| Molecular Formula | C25H22ClN5O3S2 |
| Molecular Weight | 540.07 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | ethyl 2-[[(6R,7S)-6-(4-chlorophenyl)-3-methyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carbonyl]amino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)[C@H]1Sc2nnc(C)n2N[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClN5O3S2/c1-3-34-24(33)18-13-19(15-7-5-4-6-8-15)35-23(18)27-22(32)21-20(16-9-11-17(26)12-10-16)30-31-14(2)28-29-25(31)36-21/h4-13,20-21,30H,3H2,1-2H3,(H,27,32)/t20-,21+/m1/s1 |
| InChIKey | LYVIEODMNHQKQR-RTWAWAEBSA-N |
| XLogP | 5.54 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.07 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |