C24H15Cl3F2N4O2S — CID 2428494
[(6R,7R)-6-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-[4-(difluoromethoxy)phenyl]methanone (PubChem CID 2428494) has the molecular formula C24H15Cl3F2N4O2S and a molecular weight of 567.83 g/mol. Its IUPAC name is [(6R,7R)-6-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-[4-(difluoromethoxy)phenyl]methanone.
| Compound Name | [(6R,7R)-6-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-[4-(difluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 2428494 |
| Molecular Formula | C24H15Cl3F2N4O2S |
| Molecular Weight | 567.83 g/mol |
| Exact Mass | 565.99 |
| IUPAC Name | [(6R,7R)-6-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]-[4-(difluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OC(F)F)cc1)[C@@H]1Sc2nnc(-c3ccc(Cl)cc3Cl)n2N[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15Cl3F2N4O2S/c25-14-5-1-12(2-6-14)19-21(20(34)13-3-8-16(9-4-13)35-23(28)29)36-24-31-30-22(33(24)32-19)17-10-7-15(26)11-18(17)27/h1-11,19,21,23,32H/t19-,21-/m1/s1 |
| InChIKey | NZONKEJATKDZCO-TZIWHRDSSA-N |
| XLogP | 7.15 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.83 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |