About (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate
(2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate (PubChem CID 2429069) has the molecular formula C11H13ClN2O5S
and a molecular weight of 320.75 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate |
| PubChem CID | 2429069 |
| Molecular Formula | C11H13ClN2O5S |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)OCC(N)=O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClN2O5S/c1-14(6-11(16)19-7-10(13)15)20(17,18)9-4-2-8(12)3-5-9/h2-5H,6-7H2,1H3,(H2,13,15) |
| InChIKey | BCEOOEHURIJVDL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate?
The IUPAC name of (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate (CID 2429069) is (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate.
What is the SMILES notation for (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate?
The canonical SMILES for (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate is CN(CC(=O)OCC(N)=O)S(=O)(=O)c1ccc(Cl)cc1.
What is the InChIKey of (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate?
The InChIKey is BCEOOEHURIJVDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2O5S/c1-14(6-11(16)19-7-10(13)15)20(17,18)9-4-2-8(12)3-5-9/h2-5H,6-7H2,1H3,(H2,13,15).
What are the key properties of (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate?
(2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate has a molecular weight of 320.75 g/mol, XLogP of -0.01, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) 2-[(4-chlorophenyl)sulfonyl-methylamino]acetate is sourced from PubChem (CID 2429069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).