About [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate
[2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate (PubChem CID 2429198) has the molecular formula C18H19NO3S
and a molecular weight of 329.42 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate.
Molecular Properties
| Compound Name | [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate |
| PubChem CID | 2429198 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate |
| SMILES | O=C(COC(=O)CSCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C18H19NO3S/c20-17(19-11-15-7-3-1-4-8-15)12-22-18(21)14-23-13-16-9-5-2-6-10-16/h1-10H,11-14H2,(H,19,20) |
| InChIKey | ZPAPSMHWZAGOKT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate?
The IUPAC name of [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate (CID 2429198) is [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate.
What is the SMILES notation for [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate?
The canonical SMILES for [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate is O=C(COC(=O)CSCc1ccccc1)NCc1ccccc1.
What is the InChIKey of [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate?
The InChIKey is ZPAPSMHWZAGOKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3S/c20-17(19-11-15-7-3-1-4-8-15)12-22-18(21)14-23-13-16-9-5-2-6-10-16/h1-10H,11-14H2,(H,19,20).
What are the key properties of [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate?
[2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate has a molecular weight of 329.42 g/mol, XLogP of 2.78, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(benzylamino)-2-oxoethyl] 2-benzylsulfanylacetate is sourced from PubChem (CID 2429198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).