About [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate
[2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 2430490) has the molecular formula C15H15N3O3
and a molecular weight of 285.30 g/mol. Its IUPAC name is [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate |
| PubChem CID | 2430490 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | Cc1ccc(CNC(=O)COC(=O)c2cnccn2)cc1 |
| InChI | InChI=1S/C15H15N3O3/c1-11-2-4-12(5-3-11)8-18-14(19)10-21-15(20)13-9-16-6-7-17-13/h2-7,9H,8,10H2,1H3,(H,18,19) |
| InChIKey | QINGSNUECRRYFD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate?
The IUPAC name of [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate (CID 2430490) is [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate.
What is the SMILES notation for [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate?
The canonical SMILES for [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate is Cc1ccc(CNC(=O)COC(=O)c2cnccn2)cc1.
What is the InChIKey of [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate?
The InChIKey is QINGSNUECRRYFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O3/c1-11-2-4-12(5-3-11)8-18-14(19)10-21-15(20)13-9-16-6-7-17-13/h2-7,9H,8,10H2,1H3,(H,18,19).
What are the key properties of [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate?
[2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate has a molecular weight of 285.30 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-methylphenyl)methylamino]-2-oxoethyl] pyrazine-2-carboxylate is sourced from PubChem (CID 2430490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).