About [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate (PubChem CID 2430506) has the molecular formula C16H11F2NO5
and a molecular weight of 335.26 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate.
Molecular Properties
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate |
| PubChem CID | 2430506 |
| Molecular Formula | C16H11F2NO5 |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate |
| SMILES | O=C(COC(=O)c1c(F)cccc1F)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H11F2NO5/c17-10-2-1-3-11(18)15(10)16(21)22-7-14(20)19-9-4-5-12-13(6-9)24-8-23-12/h1-6H,7-8H2,(H,19,20) |
| InChIKey | ZCZSAQJOJLZGQA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate?
The IUPAC name of [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate (CID 2430506) is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate.
What is the SMILES notation for [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate?
The canonical SMILES for [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate is O=C(COC(=O)c1c(F)cccc1F)Nc1ccc2c(c1)OCO2.
What is the InChIKey of [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate?
The InChIKey is ZCZSAQJOJLZGQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F2NO5/c17-10-2-1-3-11(18)15(10)16(21)22-7-14(20)19-9-4-5-12-13(6-9)24-8-23-12/h1-6H,7-8H2,(H,19,20).
What are the key properties of [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate?
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate has a molecular weight of 335.26 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2,6-difluorobenzoate is sourced from PubChem (CID 2430506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).