About cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate
cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 24313) has the molecular formula C19H18N2O4
and a molecular weight of 338.36 g/mol. Its IUPAC name is cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
Molecular Properties
| Compound Name | cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| PubChem CID | 24313 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | N#CCOC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18N2O4/c20-11-12-24-18(22)17(13-15-7-3-1-4-8-15)21-19(23)25-14-16-9-5-2-6-10-16/h1-10,17H,12-14H2,(H,21,23)/t17-/m0/s1 |
| InChIKey | QDAFQGLLNQPQAT-KRWDZBQOSA-N |
| XLogP | 2.59 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate?
The IUPAC name of cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (CID 24313) is cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
What is the SMILES notation for cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate?
The canonical SMILES for cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate is N#CCOC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1.
What is the InChIKey of cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate?
The InChIKey is QDAFQGLLNQPQAT-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H18N2O4/c20-11-12-24-18(22)17(13-15-7-3-1-4-8-15)21-19(23)25-14-16-9-5-2-6-10-16/h1-10,17H,12-14H2,(H,21,23)/t17-/m0/s1.
What are the key properties of cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate?
cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate has a molecular weight of 338.36 g/mol, XLogP of 2.59, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate is sourced from PubChem (CID 24313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).