C16H20ClNO4 — CID 2431382
[2-(2-methylpropylamino)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 2431382) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is [2-(2-methylpropylamino)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | [2-(2-methylpropylamino)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 2431382 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [2-(2-methylpropylamino)-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | CC(C)CNC(=O)COC(=O)CCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO4/c1-11(2)9-18-15(20)10-22-16(21)8-7-14(19)12-3-5-13(17)6-4-12/h3-6,11H,7-10H2,1-2H3,(H,18,20) |
| InChIKey | AGOSJXSBPIOEHJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |