C18H23N5OS3 — CID 2431428
2-[[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-butylacetamide (PubChem CID 2431428) has the molecular formula C18H23N5OS3 and a molecular weight of 421.62 g/mol. Its IUPAC name is 2-[[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-butylacetamide.
| Compound Name | 2-[[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-butylacetamide |
|---|---|
| PubChem CID | 2431428 |
| Molecular Formula | C18H23N5OS3 |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 2-[[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-butylacetamide |
| SMILES | CCCCNC(=O)CSc1nnc(CSc2nc3ccccc3s2)n1CC |
| InChI | InChI=1S/C18H23N5OS3/c1-3-5-10-19-16(24)12-25-17-22-21-15(23(17)4-2)11-26-18-20-13-8-6-7-9-14(13)27-18/h6-9H,3-5,10-12H2,1-2H3,(H,19,24) |
| InChIKey | OGDLOSYPPLVEGG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|