C22H25N3O3 — CID 2431577
2-(4-cyanophenoxy)-N-[(4-hexoxyphenyl)methylideneamino]acetamide (PubChem CID 2431577) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[(4-hexoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[(4-hexoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 2431577 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[(4-hexoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCCCCOc1ccc(C=NNC(=O)COc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-2-3-4-5-14-27-20-12-8-19(9-13-20)16-24-25-22(26)17-28-21-10-6-18(15-23)7-11-21/h6-13,16H,2-5,14,17H2,1H3,(H,25,26) |
| InChIKey | WLWHEFOFALUEID-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|