C10H11N3O2S — CID 2432027
5-[(2-methoxyphenoxy)methyl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 2432027) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 5-[(2-methoxyphenoxy)methyl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[(2-methoxyphenoxy)methyl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2432027 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 5-[(2-methoxyphenoxy)methyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | COc1ccccc1OCc1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C10H11N3O2S/c1-14-7-4-2-3-5-8(7)15-6-9-11-10(16)13-12-9/h2-5H,6H2,1H3,(H2,11,12,13,16) |
| InChIKey | XNCFOXOFRQJVEY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|