About [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate
[2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate (PubChem CID 2432103) has the molecular formula C13H13ClFNO3
and a molecular weight of 285.70 g/mol. Its IUPAC name is [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate.
Molecular Properties
| Compound Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate |
| PubChem CID | 2432103 |
| Molecular Formula | C13H13ClFNO3 |
| Molecular Weight | 285.70 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate |
| SMILES | O=C(COC(=O)C1CCC1)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H13ClFNO3/c14-10-6-9(4-5-11(10)15)16-12(17)7-19-13(18)8-2-1-3-8/h4-6,8H,1-3,7H2,(H,16,17) |
| InChIKey | ZLVDCILUGTUBNC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.70 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate?
The IUPAC name of [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate (CID 2432103) is [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate.
What is the SMILES notation for [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate?
The canonical SMILES for [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate is O=C(COC(=O)C1CCC1)Nc1ccc(F)c(Cl)c1.
What is the InChIKey of [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate?
The InChIKey is ZLVDCILUGTUBNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClFNO3/c14-10-6-9(4-5-11(10)15)16-12(17)7-19-13(18)8-2-1-3-8/h4-6,8H,1-3,7H2,(H,16,17).
What are the key properties of [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate?
[2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate has a molecular weight of 285.70 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] cyclobutanecarboxylate is sourced from PubChem (CID 2432103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).