C16H17Cl2NO4 — CID 2434923
(3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 2434923) has the molecular formula C16H17Cl2NO4 and a molecular weight of 358.22 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 2434923 |
| Molecular Formula | C16H17Cl2NO4 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | Cc1noc(C)c1COC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2NO4/c1-10-13(11(2)23-19-10)9-22-16(20)4-3-7-21-15-6-5-12(17)8-14(15)18/h5-6,8H,3-4,7,9H2,1-2H3 |
| InChIKey | VQYPQQITAQUIEP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|