About N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide
N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide (PubChem CID 2435085) has the molecular formula C18H28N2O3S
and a molecular weight of 352.50 g/mol. Its IUPAC name is N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide.
Molecular Properties
| Compound Name | N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide |
| PubChem CID | 2435085 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)NC2CCCCCC2)cc1C |
| InChI | InChI=1S/C18H28N2O3S/c1-14-9-10-17(13-15(14)2)24(22,23)19-12-11-18(21)20-16-7-5-3-4-6-8-16/h9-10,13,16,19H,3-8,11-12H2,1-2H3,(H,20,21) |
| InChIKey | KAFCJRDLUFNIGQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide?
The IUPAC name of N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide (CID 2435085) is N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide.
What is the SMILES notation for N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide?
The canonical SMILES for N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide is Cc1ccc(S(=O)(=O)NCCC(=O)NC2CCCCCC2)cc1C.
What is the InChIKey of N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide?
The InChIKey is KAFCJRDLUFNIGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O3S/c1-14-9-10-17(13-15(14)2)24(22,23)19-12-11-18(21)20-16-7-5-3-4-6-8-16/h9-10,13,16,19H,3-8,11-12H2,1-2H3,(H,20,21).
What are the key properties of N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide?
N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide has a molecular weight of 352.50 g/mol, XLogP of 2.81, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide is sourced from PubChem (CID 2435085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).