About 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid
3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid (PubChem CID 2435336) has the molecular formula C14H13NO6
and a molecular weight of 291.26 g/mol. Its IUPAC name is 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid.
Molecular Properties
| Compound Name | 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid |
| PubChem CID | 2435336 |
| Molecular Formula | C14H13NO6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(NC(=O)c2ccco2)c1OC |
| InChI | InChI=1S/C14H13NO6/c1-19-11-7-8(14(17)18)6-9(12(11)20-2)15-13(16)10-4-3-5-21-10/h3-7H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | QBYQMLJNOQWYID-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid?
The IUPAC name of 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid (CID 2435336) is 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid.
What is the SMILES notation for 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid?
The canonical SMILES for 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid is COc1cc(C(=O)O)cc(NC(=O)c2ccco2)c1OC.
What is the InChIKey of 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid?
The InChIKey is QBYQMLJNOQWYID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO6/c1-19-11-7-8(14(17)18)6-9(12(11)20-2)15-13(16)10-4-3-5-21-10/h3-7H,1-2H3,(H,15,16)(H,17,18).
What are the key properties of 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid?
3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid has a molecular weight of 291.26 g/mol, XLogP of 2.25, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid is sourced from PubChem (CID 2435336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).