About 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine
5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 24356) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine.
Analyze 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine?
The IUPAC name of 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (CID 24356) is 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine.
What is the SMILES notation for 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine?
The canonical SMILES for 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine is Cc1cc(C)n2ncnc2n1.
What is the InChIKey of 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine?
The InChIKey is WXVQCFALDUVKSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-5-3-6(2)11-7(10-5)8-4-9-11/h3-4H,1-2H3.
What are the key properties of 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine?
5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine has a molecular weight of 148.17 g/mol, XLogP of 0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine is sourced from PubChem (CID 24356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).