C21H27N3O2S2 — CID 2435602
N-[(1S,2S)-2-methylcyclohexyl]-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide (PubChem CID 2435602) has the molecular formula C21H27N3O2S2 and a molecular weight of 417.60 g/mol. Its IUPAC name is N-[(1S,2S)-2-methylcyclohexyl]-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide.
| Compound Name | N-[(1S,2S)-2-methylcyclohexyl]-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2435602 |
| Molecular Formula | C21H27N3O2S2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[(1S,2S)-2-methylcyclohexyl]-2-[(12-oxo-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)N[C@H]2CCCC[C@@H]2C)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C21H27N3O2S2/c1-3-11-24-20(26)18-14-8-6-10-16(14)28-19(18)23-21(24)27-12-17(25)22-15-9-5-4-7-13(15)2/h3,13,15H,1,4-12H2,2H3,(H,22,25)/t13-,15-/m0/s1 |
| InChIKey | ZOTPDWJDJLDRFF-ZFWWWQNUSA-N |
| XLogP | 3.92 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|