About (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate
(3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate (PubChem CID 2435952) has the molecular formula C21H20N2O3
and a molecular weight of 348.40 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate.
Molecular Properties
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate |
| PubChem CID | 2435952 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate |
| SMILES | CC(C)(C)C(=O)COC(=O)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C21H20N2O3/c1-21(2,3)19(24)13-26-20(25)16-12-18(14-8-10-22-11-9-14)23-17-7-5-4-6-15(16)17/h4-12H,13H2,1-3H3 |
| InChIKey | QIDGXUMBRJBSKY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate?
The IUPAC name of (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate (CID 2435952) is (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate.
What is the SMILES notation for (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate?
The canonical SMILES for (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate is CC(C)(C)C(=O)COC(=O)c1cc(-c2ccncc2)nc2ccccc12.
What is the InChIKey of (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate?
The InChIKey is QIDGXUMBRJBSKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3/c1-21(2,3)19(24)13-26-20(25)16-12-18(14-8-10-22-11-9-14)23-17-7-5-4-6-15(16)17/h4-12H,13H2,1-3H3.
What are the key properties of (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate?
(3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate has a molecular weight of 348.40 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-2-oxobutyl) 2-pyridin-4-ylquinoline-4-carboxylate is sourced from PubChem (CID 2435952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).