About [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate
[2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 2436916) has the molecular formula C20H17Cl2N3O3
and a molecular weight of 418.28 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate.
Molecular Properties
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate |
| PubChem CID | 2436916 |
| Molecular Formula | C20H17Cl2N3O3 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)OCC(=O)Nc3c(Cl)cccc3Cl)cc2)n1 |
| InChI | InChI=1S/C20H17Cl2N3O3/c1-12-10-13(2)25(24-12)15-8-6-14(7-9-15)20(27)28-11-18(26)23-19-16(21)4-3-5-17(19)22/h3-10H,11H2,1-2H3,(H,23,26) |
| InChIKey | XGKCMRPSDYYKID-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate?
The IUPAC name of [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate (CID 2436916) is [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate.
What is the SMILES notation for [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate?
The canonical SMILES for [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate is Cc1cc(C)n(-c2ccc(C(=O)OCC(=O)Nc3c(Cl)cccc3Cl)cc2)n1.
What is the InChIKey of [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate?
The InChIKey is XGKCMRPSDYYKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17Cl2N3O3/c1-12-10-13(2)25(24-12)15-8-6-14(7-9-15)20(27)28-11-18(26)23-19-16(21)4-3-5-17(19)22/h3-10H,11H2,1-2H3,(H,23,26).
What are the key properties of [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate?
[2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate has a molecular weight of 418.28 g/mol, XLogP of 4.59, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dichloroanilino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate is sourced from PubChem (CID 2436916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).