About [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate
[2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 2437075) has the molecular formula C23H25N3O4
and a molecular weight of 407.47 g/mol. Its IUPAC name is [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| PubChem CID | 2437075 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCn1cc(C(=O)OCC(=O)Nc2ccc(C(C)C)cc2)c(=O)c2ccc(C)nc21 |
| InChI | InChI=1S/C23H25N3O4/c1-5-26-12-19(21(28)18-11-6-15(4)24-22(18)26)23(29)30-13-20(27)25-17-9-7-16(8-10-17)14(2)3/h6-12,14H,5,13H2,1-4H3,(H,25,27) |
| InChIKey | NWIGQIBEGRCTTG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate?
The IUPAC name of [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate (CID 2437075) is [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate.
What is the SMILES notation for [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate?
The canonical SMILES for [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate is CCn1cc(C(=O)OCC(=O)Nc2ccc(C(C)C)cc2)c(=O)c2ccc(C)nc21.
What is the InChIKey of [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate?
The InChIKey is NWIGQIBEGRCTTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O4/c1-5-26-12-19(21(28)18-11-6-15(4)24-22(18)26)23(29)30-13-20(27)25-17-9-7-16(8-10-17)14(2)3/h6-12,14H,5,13H2,1-4H3,(H,25,27).
What are the key properties of [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate?
[2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate has a molecular weight of 407.47 g/mol, XLogP of 3.64, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-propan-2-ylanilino)ethyl] 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate is sourced from PubChem (CID 2437075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).