C16H12Cl2N2OS — CID 2437285
N-(3,4-dichlorophenyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide (PubChem CID 2437285) has the molecular formula C16H12Cl2N2OS and a molecular weight of 351.26 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide.
| Compound Name | N-(3,4-dichlorophenyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2437285 |
| Molecular Formula | C16H12Cl2N2OS |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(c1ccccc1)N(C1=NCCS1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2OS/c17-13-7-6-12(10-14(13)18)20(16-19-8-9-22-16)15(21)11-4-2-1-3-5-11/h1-7,10H,8-9H2 |
| InChIKey | FJGQBDOYRQSVNG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |