About [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 2437339) has the molecular formula C15H14ClNO3S
and a molecular weight of 323.80 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate.
Molecular Properties
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate |
| PubChem CID | 2437339 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | O=C(COC(=O)Cc1ccsc1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClNO3S/c16-13-3-1-11(2-4-13)8-17-14(18)9-20-15(19)7-12-5-6-21-10-12/h1-6,10H,7-9H2,(H,17,18) |
| InChIKey | VXNAXQIRLVKSNY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate?
The IUPAC name of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate (CID 2437339) is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate.
What is the SMILES notation for [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate?
The canonical SMILES for [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate is O=C(COC(=O)Cc1ccsc1)NCc1ccc(Cl)cc1.
What is the InChIKey of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate?
The InChIKey is VXNAXQIRLVKSNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNO3S/c16-13-3-1-11(2-4-13)8-17-14(18)9-20-15(19)7-12-5-6-21-10-12/h1-6,10H,7-9H2,(H,17,18).
What are the key properties of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate?
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate has a molecular weight of 323.80 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-thiophen-3-ylacetate is sourced from PubChem (CID 2437339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).