About 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one
4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one (PubChem CID 2437380) has the molecular formula C25H22N2O2
and a molecular weight of 382.46 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one.
Molecular Properties
| Compound Name | 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one |
| PubChem CID | 2437380 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one |
| SMILES | Cc1ccc(/N=C/c2c(O)n(-c3ccccc3C)c(=O)c3ccccc23)cc1C |
| InChI | InChI=1S/C25H22N2O2/c1-16-12-13-19(14-18(16)3)26-15-22-20-9-5-6-10-21(20)24(28)27(25(22)29)23-11-7-4-8-17(23)2/h4-15,29H,1-3H3/b26-15+ |
| InChIKey | IMGQQVKETRINDM-CVKSISIWSA-N |
| XLogP | 5.37 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one?
The IUPAC name of 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one (CID 2437380) is 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one.
What is the SMILES notation for 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one?
The canonical SMILES for 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one is Cc1ccc(/N=C/c2c(O)n(-c3ccccc3C)c(=O)c3ccccc23)cc1C.
What is the InChIKey of 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one?
The InChIKey is IMGQQVKETRINDM-CVKSISIWSA-N. The full InChI is InChI=1S/C25H22N2O2/c1-16-12-13-19(14-18(16)3)26-15-22-20-9-5-6-10-21(20)24(28)27(25(22)29)23-11-7-4-8-17(23)2/h4-15,29H,1-3H3/b26-15+.
What are the key properties of 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one?
4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one has a molecular weight of 382.46 g/mol, XLogP of 5.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dimethylphenyl)iminomethyl]-3-hydroxy-2-(2-methylphenyl)isoquinolin-1-one is sourced from PubChem (CID 2437380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).