About 4-chloro-1,3,5-triazin-2-amine
4-chloro-1,3,5-triazin-2-amine (PubChem CID 24381) has the molecular formula C3H3ClN4
and a molecular weight of 130.54 g/mol. Its IUPAC name is 4-chloro-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-chloro-1,3,5-triazin-2-amine |
| PubChem CID | 24381 |
| Molecular Formula | C3H3ClN4 |
| Molecular Weight | 130.54 g/mol |
| Exact Mass | 130.00 |
| IUPAC Name | 4-chloro-1,3,5-triazin-2-amine |
| SMILES | Nc1ncnc(Cl)n1 |
| InChI | InChI=1S/C3H3ClN4/c4-2-6-1-7-3(5)8-2/h1H,(H2,5,6,7,8) |
| InChIKey | ULVNIJSKNRGBHX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.54 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,3,5-triazin-2-amine?
The IUPAC name of 4-chloro-1,3,5-triazin-2-amine (CID 24381) is 4-chloro-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-chloro-1,3,5-triazin-2-amine?
The canonical SMILES for 4-chloro-1,3,5-triazin-2-amine is Nc1ncnc(Cl)n1.
What is the InChIKey of 4-chloro-1,3,5-triazin-2-amine?
The InChIKey is ULVNIJSKNRGBHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3ClN4/c4-2-6-1-7-3(5)8-2/h1H,(H2,5,6,7,8).
What are the key properties of 4-chloro-1,3,5-triazin-2-amine?
4-chloro-1,3,5-triazin-2-amine has a molecular weight of 130.54 g/mol, XLogP of 0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,3,5-triazin-2-amine is sourced from PubChem (CID 24381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).