C17H20N2O4S — CID 2438761
N-[(2R)-1-(4-methoxyanilino)-4-methylsulfanyl-1-oxobutan-2-yl]furan-2-carboxamide (PubChem CID 2438761) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is N-[(2R)-1-(4-methoxyanilino)-4-methylsulfanyl-1-oxobutan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2R)-1-(4-methoxyanilino)-4-methylsulfanyl-1-oxobutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2438761 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[(2R)-1-(4-methoxyanilino)-4-methylsulfanyl-1-oxobutan-2-yl]furan-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H](CCSC)NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-22-13-7-5-12(6-8-13)18-16(20)14(9-11-24-2)19-17(21)15-4-3-10-23-15/h3-8,10,14H,9,11H2,1-2H3,(H,18,20)(H,19,21)/t14-/m1/s1 |
| InChIKey | ZAWQFKUXDPFLJC-CQSZACIVSA-N |
| XLogP | 2.78 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |