C24H20N4O3S — CID 2438955
5,5-dibenzyl-3-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 2438955) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is 5,5-dibenzyl-3-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dibenzyl-3-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2438955 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 5,5-dibenzyl-3-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(Cc2ccccc2)(Cc2ccccc2)C(=O)N1Cc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C24H20N4O3S/c29-22-24(14-17-8-3-1-4-9-17,15-18-10-5-2-6-11-18)25-23(30)28(22)16-20-26-27-21(31-20)19-12-7-13-32-19/h1-13H,14-16H2,(H,25,30) |
| InChIKey | UPDSIMXTQNRGEI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|